Type: Neutral
Formula: C10H10N8O4
SMILES: |
O=C1N=C(N)C(NC(=O)C(=O)NC2=CNC(=O)N=C2N)=CN1 |
InChI: |
InChI=1/C10H10N8O4/c11-5-3(1-13-9(21)17-5)15-7(19)8(20)16-4-2-14-10(22)18-6(4)12/h1-2H,(H,15,19)(H,16,20)(H3,11,13,17,21)(H3,12,14,18,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 306.242 g/mol | logS: -2.11332 | SlogP: -2.9376 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.058537 | Sterimol/B1: 2.23339 | Sterimol/B2: 2.24772 | Sterimol/B3: 3.97553 |
Sterimol/B4: 5.05406 | Sterimol/L: 17.1155 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.297 | Positive charged surface: 289.712 | Negative charged surface: 206.585 | Volume: 236.875 |
Hydrophobic surface: 89.281 | Hydrophilic surface: 407.016 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |