 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P1(OC2C(O1)C(OC2CO)n1c2N=C(NC(=O)c2nc1)N)(=O)[O-] |
| InChI: | InChI=1/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-6-5(3(1-16)20-9)21-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/p-1/t3-,5+,6+,9-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=3.38303 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 344.2 g/mol | logS: -1.22132 | SlogP: -3.2599 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.172996 | Sterimol/B1: 2.41908 | Sterimol/B2: 3.89808 | Sterimol/B3: 4.45435 | |||
| Sterimol/B4: 6.28136 | Sterimol/L: 13.1827 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 484.522 | Positive charged surface: 290.992 | Negative charged surface: 193.53 | Volume: 250.5 | |||
| Hydrophobic surface: 145.601 | Hydrophilic surface: 338.921 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
