Type: Neutral
Formula: C15H20N2O8
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OCc1ccc([N+](=O)[O-])cc1 |
InChI: |
InChI=1/C15H20N2O8/c1-8(19)16-12-14(21)13(20)11(6-18)25-15(12)24-7-9-2-4-10(5-3-9)17(22)23/h2-5,11-15,18,20-21H,6-7H2,1H3,(H,16,19)/t11-,12+,13+,14+,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 356.331 g/mol | logS: -2.03583 | SlogP: -0.6785 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.158477 | Sterimol/B1: 2.46259 | Sterimol/B2: 2.48644 | Sterimol/B3: 5.55679 |
Sterimol/B4: 9.31564 | Sterimol/L: 15.4845 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.863 | Positive charged surface: 361.865 | Negative charged surface: 236.998 | Volume: 306.375 |
Hydrophobic surface: 346.533 | Hydrophilic surface: 252.33 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |