 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C |
| InChI: | InChI=1/C18H18N6O5S2/c1-23-18(20-21-22-23)31-8-10-7-30-16-11(15(27)24(16)12(10)17(28)29)19-14(26)13(25)9-5-3-2-4-6-9/h2-6,11,13,16,25H,7-8H2,1H3,(H,19,26)(H,28,29)/t11-,13-,16+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=139.552 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 462.511 g/mol | logS: -4.40421 | SlogP: 0.2291 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0636766 | Sterimol/B1: 2.33399 | Sterimol/B2: 3.04632 | Sterimol/B3: 5.84472 | |||
| Sterimol/B4: 6.86842 | Sterimol/L: 19.1453 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 692.34 | Positive charged surface: 351.453 | Negative charged surface: 282.336 | Volume: 383 | |||
| Hydrophobic surface: 380.81 | Hydrophilic surface: 311.53 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
