 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(O)=O |
| InChI: | InChI=1/C21H35N5O5/c22-11-3-1-5-16(24)19(28)26-18(13-14-7-9-15(27)10-8-14)20(29)25-17(21(30)31)6-2-4-12-23/h7-10,16-18,27H,1-6,11-13,22-24H2,(H,25,29)(H,26,28)(H,30,31)/t16-,17+,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=86.4936 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 437.541 g/mol | logS: -1.68364 | SlogP: -0.42583 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0960873 | Sterimol/B1: 3.25809 | Sterimol/B2: 5.20212 | Sterimol/B3: 6.22687 | |||
| Sterimol/B4: 7.05492 | Sterimol/L: 21.0574 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 763.719 | Positive charged surface: 567.68 | Negative charged surface: 196.039 | Volume: 426.25 | |||
| Hydrophobic surface: 394.078 | Hydrophilic surface: 369.641 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
