Type: Neutral
Formula: C11H16N2O5
SMILES: |
O1CC(O)C(CO)C1N1C=C(CC)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O5/c1-2-6-3-13(11(17)12-9(6)16)10-7(4-14)8(15)5-18-10/h3,7-8,10,14-15H,2,4-5H2,1H3,(H,12,16,17)/t7-,8-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 256.258 g/mol | logS: -0.68269 | SlogP: -0.8422 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0985759 | Sterimol/B1: 2.23093 | Sterimol/B2: 3.25305 | Sterimol/B3: 4.41174 |
Sterimol/B4: 5.9261 | Sterimol/L: 12.2803 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 446.501 | Positive charged surface: 313.634 | Negative charged surface: 132.867 | Volume: 225.125 |
Hydrophobic surface: 213.636 | Hydrophilic surface: 232.865 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |