Type: Neutral
Formula: C17H31N3O4
SMILES: |
OC(=O)C(NC(=O)C1N(CCC1)C(=O)C(N)C(CC)C)C(CC)C |
InChI: |
InChI=1/C17H31N3O4/c1-5-10(3)13(18)16(22)20-9-7-8-12(20)15(21)19-14(17(23)24)11(4)6-2/h10-14H,5-9,18H2,1-4H3,(H,19,21)(H,23,24)/t10-,11+,12-,13-,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.452 g/mol | logS: -2.56121 | SlogP: 0.9663 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0837346 | Sterimol/B1: 2.56247 | Sterimol/B2: 2.86938 | Sterimol/B3: 5.45006 |
Sterimol/B4: 7.76136 | Sterimol/L: 17.2653 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.643 | Positive charged surface: 437.534 | Negative charged surface: 164.109 | Volume: 341.625 |
Hydrophobic surface: 378.2 | Hydrophilic surface: 223.443 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |