Type: Neutral
Formula: C18H28N2O4
SMILES: |
O(Cc1ccccc1)C(C(NC(OC(C)(C)C)=O)C(=O)NCC)C |
InChI: |
InChI=1/C18H28N2O4/c1-6-19-16(21)15(20-17(22)24-18(3,4)5)13(2)23-12-14-10-8-7-9-11-14/h7-11,13,15H,6,12H2,1-5H3,(H,19,21)(H,20,22)/t13-,15+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 336.432 g/mol | logS: -3.55909 | SlogP: 2.8875 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.166165 | Sterimol/B1: 2.12915 | Sterimol/B2: 3.92445 | Sterimol/B3: 5.25652 |
Sterimol/B4: 10.5631 | Sterimol/L: 15.2854 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 641.018 | Positive charged surface: 422.177 | Negative charged surface: 218.841 | Volume: 344.625 |
Hydrophobic surface: 479.932 | Hydrophilic surface: 161.086 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |