Type: Neutral
Formula: C18H28N2O4
| SMILES: |
O(Cc1ccccc1)C(C(NC(OC(C)(C)C)=O)C(=O)NCC)C |
| InChI: |
InChI=1/C18H28N2O4/c1-6-19-16(21)15(20-17(22)24-18(3,4)5)13(2)23-12-14-10-8-7-9-11-14/h7-11,13,15H,6,12H2,1-5H3,(H,19,21)(H,20,22)/t13-,15-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 336.432 g/mol | logS: -3.55909 | SlogP: 2.8875 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0555638 | Sterimol/B1: 2.50288 | Sterimol/B2: 3.34452 | Sterimol/B3: 3.63039 |
| Sterimol/B4: 8.13922 | Sterimol/L: 17.9251 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 615.24 | Positive charged surface: 411.86 | Negative charged surface: 203.38 | Volume: 345.5 |
| Hydrophobic surface: 459.375 | Hydrophilic surface: 155.865 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |