 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1CCCCC1[NH2+]C1CC[NH+](CC1)CC(O)Cn1c2c(cccc2)cc1 |
| InChI: | InChI=1/C22H33N3O2/c26-19(16-25-14-9-17-5-1-3-7-21(17)25)15-24-12-10-18(11-13-24)23-20-6-2-4-8-22(20)27/h1,3,5,7,9,14,18-20,22-23,26-27H,2,4,6,8,10-13,15-16H2/p+2/t19-,20-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=58.5278 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 373.541 g/mol | logS: -2.28806 | SlogP: 0.1828 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0568401 | Sterimol/B1: 2.3495 | Sterimol/B2: 3.12622 | Sterimol/B3: 5.27758 | |||
| Sterimol/B4: 6.27386 | Sterimol/L: 20.3638 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 687.344 | Positive charged surface: 515.57 | Negative charged surface: 165.828 | Volume: 392.125 | |||
| Hydrophobic surface: 578.323 | Hydrophilic surface: 109.021 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
