Type: Neutral
Formula: C16H17IN2O6S
SMILES: |
IC1=CN(C2OC(CS(=O)(=O)c3ccc(cc3)C)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C16H17IN2O6S/c1-9-2-4-10(5-3-9)26(23,24)8-13-12(20)6-14(25-13)19-7-11(17)15(21)18-16(19)22/h2-5,7,12-14,20H,6,8H2,1H3,(H,18,21,22)/t12-,13+,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 492.29 g/mol | logS: -4.76127 | SlogP: 1.18172 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0525825 | Sterimol/B1: 2.36591 | Sterimol/B2: 5.15145 | Sterimol/B3: 5.9309 |
Sterimol/B4: 6.63079 | Sterimol/L: 16.818 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.942 | Positive charged surface: 301.83 | Negative charged surface: 324.112 | Volume: 344.875 |
Hydrophobic surface: 419.223 | Hydrophilic surface: 206.719 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |