Type: Ionized
Formula: C8H5O8-3
| SMILES: |
OC(=O)C1C(C(=O)[O-])C(C(=O)[O-])C1C(=O)[O-] |
| InChI: |
InChI=1/C8H8O8/c9-5(10)1-2(6(11)12)4(8(15)16)3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/p-3/t1-,2+,3-,4+ |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 229.12 g/mol | logS: 0.46999 | SlogP: -5.2009 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.381371 | Sterimol/B1: 2.58805 | Sterimol/B2: 4.58507 | Sterimol/B3: 4.83724 |
| Sterimol/B4: 4.83729 | Sterimol/L: 9.94505 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 354.541 | Positive charged surface: 63.2136 | Negative charged surface: 224.752 | Volume: 167.75 |
| Hydrophobic surface: 70.0295 | Hydrophilic surface: 284.5115 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 6 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|