Type: Neutral
Formula: C14H17N3O4
SMILES: |
O1c2cccnc2NC(=O)C1(C(=O)NCC1OCCC1)C |
InChI: |
InChI=1/C14H17N3O4/c1-14(12(18)16-8-9-4-3-7-20-9)13(19)17-11-10(21-14)5-2-6-15-11/h2,5-6,9H,3-4,7-8H2,1H3,(H,16,18)(H,15,17,19)/t9-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 291.307 g/mol | logS: -2.03411 | SlogP: 0.4664 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0651998 | Sterimol/B1: 1.969 | Sterimol/B2: 3.95725 | Sterimol/B3: 5.28778 |
Sterimol/B4: 5.87217 | Sterimol/L: 15.8275 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 520.925 | Positive charged surface: 375.65 | Negative charged surface: 145.275 | Volume: 264.375 |
Hydrophobic surface: 373.865 | Hydrophilic surface: 147.06 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |