Type: Neutral
Formula: C13H16F2N2O3
SMILES: |
Fc1cc(F)ccc1NC(=O)CC(NCCC)C(O)=O |
InChI: |
InChI=1/C13H16F2N2O3/c1-2-5-16-11(13(19)20)7-12(18)17-10-4-3-8(14)6-9(10)15/h3-4,6,11,16H,2,5,7H2,1H3,(H,17,18)(H,19,20)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 286.278 g/mol | logS: -2.35061 | SlogP: 1.7462 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0772684 | Sterimol/B1: 2.32002 | Sterimol/B2: 3.3186 | Sterimol/B3: 3.46658 |
Sterimol/B4: 8.37248 | Sterimol/L: 14.0655 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 521.66 | Positive charged surface: 318.304 | Negative charged surface: 203.356 | Volume: 252.5 |
Hydrophobic surface: 369.191 | Hydrophilic surface: 152.469 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |