 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1ccc(cc1[N+](=O)[O-])C)CC([NH2+]CCC[NH3+])C(=O)[O-] |
| InChI: | InChI=1/C14H20N4O5/c1-9-3-4-10(12(7-9)18(22)23)17-13(19)8-11(14(20)21)16-6-2-5-15/h3-4,7,11,16H,2,5-6,8,15H2,1H3,(H,17,19)(H,20,21)/p+1/t11-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=44.5913 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 325.345 g/mol | logS: -2.60062 | SlogP: -2.45428 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.02335 | Sterimol/B1: 2.45195 | Sterimol/B2: 2.89869 | Sterimol/B3: 2.92319 | |||
| Sterimol/B4: 8.44876 | Sterimol/L: 17.1821 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 590.772 | Positive charged surface: 369.097 | Negative charged surface: 221.676 | Volume: 300.125 | |||
| Hydrophobic surface: 323.125 | Hydrophilic surface: 267.647 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
