 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1ccc(cc1C)C)CC([NH2+]CCC[NH3+])C(=O)[O-] |
| InChI: | InChI=1/C15H23N3O3/c1-10-4-5-12(11(2)8-10)18-14(19)9-13(15(20)21)17-7-3-6-16/h4-5,8,13,17H,3,6-7,9,16H2,1-2H3,(H,18,19)(H,20,21)/p+1/t13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=30.6465 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 294.375 g/mol | logS: -1.97086 | SlogP: -2.05406 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0246554 | Sterimol/B1: 2.42156 | Sterimol/B2: 2.85581 | Sterimol/B3: 2.91444 | |||
| Sterimol/B4: 8.59904 | Sterimol/L: 17.2057 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 587.249 | Positive charged surface: 409.68 | Negative charged surface: 177.569 | Volume: 296.875 | |||
| Hydrophobic surface: 392.74 | Hydrophilic surface: 194.509 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
