Type: Neutral
Formula: C15H22N2O4
SMILES: |
OC(CNC(CC(=O)Nc1ccc(cc1C)C)C(O)=O)C |
InChI: |
InChI=1/C15H22N2O4/c1-9-4-5-12(10(2)6-9)17-14(19)7-13(15(20)21)16-8-11(3)18/h4-6,11,13,16,18H,7-8H2,1-3H3,(H,17,19)(H,20,21)/t11-,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.351 g/mol | logS: -1.99073 | SlogP: 1.05564 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0824058 | Sterimol/B1: 2.97462 | Sterimol/B2: 3.11361 | Sterimol/B3: 4.37599 |
Sterimol/B4: 7.32589 | Sterimol/L: 15.1467 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 570.479 | Positive charged surface: 378.728 | Negative charged surface: 191.752 | Volume: 286.625 |
Hydrophobic surface: 389.795 | Hydrophilic surface: 180.684 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |