Type: Neutral
Formula: C17H20N2O4
SMILES: |
OC(CNC(CC(=O)Nc1c2c(ccc1)cccc2)C(O)=O)C |
InChI: |
InChI=1/C17H20N2O4/c1-11(20)10-18-15(17(22)23)9-16(21)19-14-8-4-6-12-5-2-3-7-13(12)14/h2-8,11,15,18,20H,9-10H2,1H3,(H,19,21)(H,22,23)/t11-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 316.357 g/mol | logS: -3.23422 | SlogP: 1.592 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0853187 | Sterimol/B1: 2.21201 | Sterimol/B2: 3.02902 | Sterimol/B3: 4.66343 |
Sterimol/B4: 8.0398 | Sterimol/L: 16.057 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 570.512 | Positive charged surface: 352.517 | Negative charged surface: 207.735 | Volume: 301.25 |
Hydrophobic surface: 392.102 | Hydrophilic surface: 178.41 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |