Type: Neutral
Formula: C13H18N2O5
SMILES: |
Oc1cc(NC(=O)CC(NCC(O)C)C(O)=O)ccc1 |
InChI: |
InChI=1/C13H18N2O5/c1-8(16)7-14-11(13(19)20)6-12(18)15-9-3-2-4-10(17)5-9/h2-5,8,11,14,16-17H,6-7H2,1H3,(H,15,18)(H,19,20)/t8-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 282.296 g/mol | logS: -0.99439 | SlogP: 0.1444 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0732543 | Sterimol/B1: 2.33056 | Sterimol/B2: 3.1802 | Sterimol/B3: 3.64977 |
Sterimol/B4: 8.38052 | Sterimol/L: 14.7772 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 527.993 | Positive charged surface: 351.827 | Negative charged surface: 176.166 | Volume: 261.25 |
Hydrophobic surface: 285.841 | Hydrophilic surface: 242.152 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |