Type: Neutral
Formula: C19H22N2O3
SMILES: |
O(CC)c1ccc(NC(=O)C(=O)NCCCc2ccccc2)cc1 |
InChI: |
InChI=1/C19H22N2O3/c1-2-24-17-12-10-16(11-13-17)21-19(23)18(22)20-14-6-9-15-7-4-3-5-8-15/h3-5,7-8,10-13H,2,6,9,14H2,1H3,(H,20,22)(H,21,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.396 g/mol | logS: -4.16827 | SlogP: 2.77277 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0236969 | Sterimol/B1: 2.61322 | Sterimol/B2: 3.6519 | Sterimol/B3: 3.84972 |
Sterimol/B4: 5.67419 | Sterimol/L: 22.3612 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 647.054 | Positive charged surface: 414.172 | Negative charged surface: 232.882 | Volume: 327.25 |
Hydrophobic surface: 515.898 | Hydrophilic surface: 131.156 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |