Type: Neutral
Formula: C15H22N2O5
SMILES: |
Oc1ccc(cc1NC(=O)CC(NCCCOC)C(O)=O)C |
InChI: |
InChI=1/C15H22N2O5/c1-10-4-5-13(18)11(8-10)17-14(19)9-12(15(20)21)16-6-3-7-22-2/h4-5,8,12,16,18H,3,6-7,9H2,1-2H3,(H,17,19)(H,20,21)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.35 g/mol | logS: -1.68805 | SlogP: 1.10852 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0966482 | Sterimol/B1: 2.36269 | Sterimol/B2: 2.44045 | Sterimol/B3: 5.88125 |
Sterimol/B4: 9.46055 | Sterimol/L: 15.5929 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 596.874 | Positive charged surface: 441.255 | Negative charged surface: 155.618 | Volume: 297.5 |
Hydrophobic surface: 415.686 | Hydrophilic surface: 181.188 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |