 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)([O-])(=[NH])c1ccc(cc1)CCNC(=O)C(=O)Nc1ccc(cc1)CC |
| InChI: | InChI=1/C18H21N3O4S/c1-2-13-3-7-15(8-4-13)21-18(23)17(22)20-12-11-14-5-9-16(10-6-14)26(19,24)25/h3-10H,2,11-12H2,1H3,(H4,19,20,21,22,23,24,25)/p-1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=58.6526 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 374.441 g/mol | logS: -4.82905 | SlogP: 1.51794 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0202576 | Sterimol/B1: 2.18061 | Sterimol/B2: 3.74174 | Sterimol/B3: 3.85038 | |||
| Sterimol/B4: 4.51736 | Sterimol/L: 22.6984 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 658.908 | Positive charged surface: 359.044 | Negative charged surface: 299.864 | Volume: 343.375 | |||
| Hydrophobic surface: 436.904 | Hydrophilic surface: 222.004 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
