Type: Neutral
Formula: C16H23N3O4S
SMILES: |
S(=O)(=O)(N1CCCC1CNC(=O)C(=O)NC)c1cc(ccc1C)C |
InChI: |
InChI=1/C16H23N3O4S/c1-11-6-7-12(2)14(9-11)24(22,23)19-8-4-5-13(19)10-18-16(21)15(20)17-3/h6-7,9,13H,4-5,8,10H2,1-3H3,(H,17,20)(H,18,21)/t13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.443 g/mol | logS: -2.83035 | SlogP: 0.31874 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117444 | Sterimol/B1: 2.44457 | Sterimol/B2: 3.73781 | Sterimol/B3: 4.56458 |
Sterimol/B4: 10.2905 | Sterimol/L: 15.0106 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 574.622 | Positive charged surface: 390.029 | Negative charged surface: 184.594 | Volume: 324.875 |
Hydrophobic surface: 424.595 | Hydrophilic surface: 150.027 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |