Type: Neutral
Formula: C18H19FN2O3S
SMILES: |
S(=O)(=O)(N1CCCC1CNC(=O)c1cc(F)ccc1)c1ccccc1 |
InChI: |
InChI=1/C18H19FN2O3S/c19-15-7-4-6-14(12-15)18(22)20-13-16-8-5-11-21(16)25(23,24)17-9-2-1-3-10-17/h1-4,6-7,9-10,12,16H,5,8,11,13H2,(H,20,22)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.425 g/mol | logS: -4.08627 | SlogP: 2.4088 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0625141 | Sterimol/B1: 2.39756 | Sterimol/B2: 2.63523 | Sterimol/B3: 4.98428 |
Sterimol/B4: 9.04563 | Sterimol/L: 16.1046 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 579.31 | Positive charged surface: 316.049 | Negative charged surface: 263.26 | Volume: 323.625 |
Hydrophobic surface: 491.511 | Hydrophilic surface: 87.799 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |