Type: Neutral
Formula: C17H19ClN2O4S2
SMILES: |
Clc1ccc(S(=O)(=O)C(CNC(=O)C(=O)NCCC)c2sccc2)cc1 |
InChI: |
InChI=1/C17H19ClN2O4S2/c1-2-9-19-16(21)17(22)20-11-15(14-4-3-10-25-14)26(23,24)13-7-5-12(18)6-8-13/h3-8,10,15H,2,9,11H2,1H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 414.934 g/mol | logS: -4.70855 | SlogP: 2.6544 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0367509 | Sterimol/B1: 3.72589 | Sterimol/B2: 3.92615 | Sterimol/B3: 4.50315 |
Sterimol/B4: 6.16056 | Sterimol/L: 20.029 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 645.402 | Positive charged surface: 332.106 | Negative charged surface: 313.297 | Volume: 355.25 |
Hydrophobic surface: 489.663 | Hydrophilic surface: 155.739 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |