Type: Neutral
Formula: C13H16N2O8
SMILES: |
O1C(CO)C(OC(=O)C)C(OC(=O)C)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C13H16N2O8/c1-6(17)21-10-8(5-16)23-12(11(10)22-7(2)18)15-4-3-9(19)14-13(15)20/h3-4,8,10-12,16H,5H2,1-2H3,(H,14,19,20)/t8-,10+,11+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.277 g/mol | logS: -1.10779 | SlogP: -1.3675 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.201565 | Sterimol/B1: 3.40727 | Sterimol/B2: 4.34419 | Sterimol/B3: 4.83856 |
Sterimol/B4: 6.81829 | Sterimol/L: 13.7797 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 517.554 | Positive charged surface: 309.406 | Negative charged surface: 208.148 | Volume: 274.25 |
Hydrophobic surface: 285.234 | Hydrophilic surface: 232.32 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |