Type: Neutral
Formula: C14H18N2O8
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1Oc1ccc([N+](=O)[O-])cc1 |
InChI: |
InChI=1/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11+,12+,13+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.304 g/mol | logS: -1.97001 | SlogP: -1.0827 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.142149 | Sterimol/B1: 2.21184 | Sterimol/B2: 2.49366 | Sterimol/B3: 5.50211 |
Sterimol/B4: 8.33735 | Sterimol/L: 14.5729 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 553.056 | Positive charged surface: 330.343 | Negative charged surface: 222.713 | Volume: 286.75 |
Hydrophobic surface: 309.467 | Hydrophilic surface: 243.589 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |