Type: Neutral
Formula: C8H11N3O6
SMILES: |
O1CC(O)C(O)C(O)C1N1N=CC(=O)NC1=O |
InChI: |
InChI=1/C8H11N3O6/c12-3-2-17-7(6(15)5(3)14)11-8(16)10-4(13)1-9-11/h1,3,5-7,12,14-15H,2H2,(H,10,13,16)/t3-,5-,6-,7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 245.191 g/mol | logS: 0.16168 | SlogP: -3.037 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.153668 | Sterimol/B1: 2.3059 | Sterimol/B2: 3.44926 | Sterimol/B3: 4.26562 |
Sterimol/B4: 4.77483 | Sterimol/L: 12.9529 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 404.585 | Positive charged surface: 281.792 | Negative charged surface: 122.793 | Volume: 192.125 |
Hydrophobic surface: 116.871 | Hydrophilic surface: 287.714 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |