Type: Neutral
Formula: C12H16N2O6
SMILES: |
O1C(C2OC(OC2C1N1C=CC(=O)NC1=O)(C)C)CO |
InChI: |
InChI=1/C12H16N2O6/c1-12(2)19-8-6(5-15)18-10(9(8)20-12)14-4-3-7(16)13-11(14)17/h3-4,6,8-10,15H,5H2,1-2H3,(H,13,16,17)/t6-,8-,9+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.268 g/mol | logS: -1.42123 | SlogP: -0.7108 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.252021 | Sterimol/B1: 3.15721 | Sterimol/B2: 3.76378 | Sterimol/B3: 4.11779 |
Sterimol/B4: 7.97542 | Sterimol/L: 12.0159 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 468.272 | Positive charged surface: 299.376 | Negative charged surface: 168.897 | Volume: 242.125 |
Hydrophobic surface: 237.286 | Hydrophilic surface: 230.986 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |