 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCCCC1)c1ccc(cc1)C(=O)NC(C(O)=O)c1ccccc1 |
| InChI: | InChI=1/C20H22N2O5S/c23-19(21-18(20(24)25)15-7-3-1-4-8-15)16-9-11-17(12-10-16)28(26,27)22-13-5-2-6-14-22/h1,3-4,7-12,18H,2,5-6,13-14H2,(H,21,23)(H,24,25)/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.8557 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 402.471 g/mol | logS: -3.96246 | SlogP: 2.5124 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0548932 | Sterimol/B1: 2.44198 | Sterimol/B2: 3.41016 | Sterimol/B3: 4.63469 | |||
| Sterimol/B4: 7.53054 | Sterimol/L: 17.802 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 660.992 | Positive charged surface: 375.613 | Negative charged surface: 285.379 | Volume: 362.625 | |||
| Hydrophobic surface: 490.866 | Hydrophilic surface: 170.126 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
