Type: Neutral
Formula: C10H15N3O4
SMILES: |
O=C1NC(=O)NC(=C1)CC(=O)NC(CC)CO |
InChI: |
InChI=1/C10H15N3O4/c1-2-6(5-14)11-8(15)3-7-4-9(16)13-10(17)12-7/h4,6,14H,2-3,5H2,1H3,(H,11,15)(H2,12,13,16,17)/t6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 241.247 g/mol | logS: -1.09278 | SlogP: -1.0131 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.082322 | Sterimol/B1: 2.4978 | Sterimol/B2: 2.95332 | Sterimol/B3: 3.79209 |
Sterimol/B4: 5.96664 | Sterimol/L: 13.2678 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 448.931 | Positive charged surface: 309.879 | Negative charged surface: 139.052 | Volume: 215.625 |
Hydrophobic surface: 205.34 | Hydrophilic surface: 243.591 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |