Type: Neutral
Formula: C19H22N2O4
SMILES: |
O(C)c1ccc(NC(=O)CC(NC(C)c2ccccc2)C(O)=O)cc1 |
InChI: |
InChI=1/C19H22N2O4/c1-13(14-6-4-3-5-7-14)20-17(19(23)24)12-18(22)21-15-8-10-16(25-2)11-9-15/h3-11,13,17,20H,12H2,1-2H3,(H,21,22)(H,23,24)/t13-,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.395 g/mol | logS: -3.37716 | SlogP: 2.9233 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.116725 | Sterimol/B1: 2.82747 | Sterimol/B2: 4.97824 | Sterimol/B3: 5.87132 |
Sterimol/B4: 6.77409 | Sterimol/L: 15.1827 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 617.649 | Positive charged surface: 405.471 | Negative charged surface: 212.178 | Volume: 331.125 |
Hydrophobic surface: 482 | Hydrophilic surface: 135.649 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |