Type: Neutral
Formula: C6H17NO7P2
| SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)CCCCCN |
| InChI: |
InChI=1/C6H17NO7P2/c7-5-3-1-2-4-6(8,15(9,10)11)16(12,13)14/h8H,1-5,7H2,(H2,9,10,11)(H2,12,13,14) |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 277.15 g/mol | logS: 1.34068 | SlogP: -2.6334 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0814088 | Sterimol/B1: 3.34087 | Sterimol/B2: 3.7535 | Sterimol/B3: 3.79647 |
| Sterimol/B4: 5.0918 | Sterimol/L: 14.4983 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 455.044 | Positive charged surface: 300.951 | Negative charged surface: 154.094 | Volume: 217.75 |
| Hydrophobic surface: 135.598 | Hydrophilic surface: 319.446 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 0 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|