Type: Neutral
Formula: C16H19N3O3
SMILES: |
O1CCCC1CNC=1NC(=O)N(c2ccccc2C)C(=O)C=1 |
InChI: |
InChI=1/C16H19N3O3/c1-11-5-2-3-7-13(11)19-15(20)9-14(18-16(19)21)17-10-12-6-4-8-22-12/h2-3,5,7,9,12,17H,4,6,8,10H2,1H3,(H,18,21)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 301.346 g/mol | logS: -3.10811 | SlogP: 1.66122 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0624835 | Sterimol/B1: 2.13696 | Sterimol/B2: 3.79254 | Sterimol/B3: 4.1266 |
Sterimol/B4: 6.38492 | Sterimol/L: 17.4427 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 545.825 | Positive charged surface: 356.096 | Negative charged surface: 189.729 | Volume: 284.5 |
Hydrophobic surface: 431.437 | Hydrophilic surface: 114.388 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |