 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCC(NC(=O)CCCc1c2c([nH]c1)cccc2)C(=O)[O-])C |
| InChI: | InChI=1/C17H22N2O3S/c1-23-10-9-15(17(21)22)19-16(20)8-4-5-12-11-18-14-7-3-2-6-13(12)14/h2-3,6-7,11,15,18H,4-5,8-10H2,1H3,(H,19,20)(H,21,22)/p-1/t15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=38.5564 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 333.432 g/mol | logS: -3.41601 | SlogP: 1.47837 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0761771 | Sterimol/B1: 2.38773 | Sterimol/B2: 3.03225 | Sterimol/B3: 4.68305 | |||
| Sterimol/B4: 8.88207 | Sterimol/L: 16.5439 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 621.031 | Positive charged surface: 357.639 | Negative charged surface: 259.363 | Volume: 324.25 | |||
| Hydrophobic surface: 416.948 | Hydrophilic surface: 204.083 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
