Type: Neutral
Formula: C11H21NO6P-
SMILES: |
P(O)(=O)(CC(CC(C)C)C(=O)[O-])CCC([NH3+])C(=O)[O-] |
InChI: |
InChI=1/C11H22NO6P/c1-7(2)5-8(10(13)14)6-19(17,18)4-3-9(12)11(15)16/h7-9H,3-6,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/p-1/t8-,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.264 g/mol | logS: -1.02231 | SlogP: -3.6507 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0691681 | Sterimol/B1: 2.21317 | Sterimol/B2: 3.92513 | Sterimol/B3: 3.9741 |
Sterimol/B4: 4.84123 | Sterimol/L: 16.3537 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 505.46 | Positive charged surface: 306.828 | Negative charged surface: 198.632 | Volume: 260.25 |
Hydrophobic surface: 242.39 | Hydrophilic surface: 263.07 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 1 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |