Type: Ionized
Formula: C8H14NO6P-2
SMILES: |
P(=O)([O-])(CC(C(=O)[O-])C)CCC([NH3+])C(=O)[O-] |
InChI: |
InChI=1/C8H16NO6P/c1-5(7(10)11)4-16(14,15)3-2-6(9)8(12)13/h5-6H,2-4,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/p-2/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 251.175 g/mol | logS: 0.45183 | SlogP: -5.3089 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0816533 | Sterimol/B1: 1.98864 | Sterimol/B2: 3.38596 | Sterimol/B3: 3.98909 |
Sterimol/B4: 5.33393 | Sterimol/L: 14.2931 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 427.809 | Positive charged surface: 227.714 | Negative charged surface: 200.095 | Volume: 207.625 |
Hydrophobic surface: 160.63 | Hydrophilic surface: 267.179 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 0 | Acid groups: 6 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|