Type: Neutral
Formula: C8H16NO6P
SMILES: |
P(O)(=O)(CC(C(O)=O)C)CCC(N)C(O)=O |
InChI: |
InChI=1/C8H16NO6P/c1-5(7(10)11)4-16(14,15)3-2-6(9)8(12)13/h5-6H,2-4,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 253.191 g/mol | logS: 1.01986 | SlogP: -1.2907 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.086941 | Sterimol/B1: 2.14434 | Sterimol/B2: 2.88247 | Sterimol/B3: 4.62835 |
Sterimol/B4: 4.92259 | Sterimol/L: 14.9714 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 454.976 | Positive charged surface: 283.773 | Negative charged surface: 171.203 | Volume: 214.875 |
Hydrophobic surface: 139.452 | Hydrophilic surface: 315.524 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|