Type: Neutral
Formula: C23H22N4O3
SMILES: |
O=C1N(C(Cc2ccccc2)C(=O)NCCCn2ccnc2)C(=O)c2c1cccc2 |
InChI: |
InChI=1/C23H22N4O3/c28-21(25-11-6-13-26-14-12-24-16-26)20(15-17-7-2-1-3-8-17)27-22(29)18-9-4-5-10-19(18)23(27)30/h1-5,7-10,12,14,16,20H,6,11,13,15H2,(H,25,28)/t20-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 402.454 g/mol | logS: -4.43101 | SlogP: 2.56327 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0634399 | Sterimol/B1: 2.61648 | Sterimol/B2: 3.96002 | Sterimol/B3: 3.98629 |
Sterimol/B4: 9.47915 | Sterimol/L: 18.6564 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 688.033 | Positive charged surface: 434.399 | Negative charged surface: 253.633 | Volume: 387.75 |
Hydrophobic surface: 568.448 | Hydrophilic surface: 119.585 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |