Type: Ionized
Formula: C10H17NO6P-3
SMILES: |
P(=O)([O-])(CCC(N)(C(C)C)C(=O)[O-])CCC(=O)[O-] |
InChI: |
InChI=1/C10H20NO6P/c1-7(2)10(11,9(14)15)4-6-18(16,17)5-3-8(12)13/h7H,3-6,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17)/p-3/t10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.221 g/mol | logS: -0.10154 | SlogP: -3.8119 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.10393 | Sterimol/B1: 2.29639 | Sterimol/B2: 2.8837 | Sterimol/B3: 4.92431 |
Sterimol/B4: 5.27898 | Sterimol/L: 15.0175 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 485.061 | Positive charged surface: 245.827 | Negative charged surface: 239.234 | Volume: 242.25 |
Hydrophobic surface: 185.187 | Hydrophilic surface: 299.874 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 6 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|