Type: Neutral
Formula: C19H27NO6
SMILES: |
O1C2C(OC(OC2)(C)C)C(O)C(NC(=O)C)C1OCCc1ccccc1 |
InChI: |
InChI=1/C19H27NO6/c1-12(21)20-15-16(22)17-14(11-24-19(2,3)26-17)25-18(15)23-10-9-13-7-5-4-6-8-13/h4-8,14-18,22H,9-11H2,1-3H3,(H,20,21)/t14-,15-,16-,17+,18+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 365.426 g/mol | logS: -2.85665 | SlogP: 0.98767 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0833545 | Sterimol/B1: 2.12707 | Sterimol/B2: 3.64061 | Sterimol/B3: 3.7416 |
Sterimol/B4: 10.397 | Sterimol/L: 16.4004 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 643.193 | Positive charged surface: 428.798 | Negative charged surface: 214.395 | Volume: 349.625 |
Hydrophobic surface: 505.487 | Hydrophilic surface: 137.706 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |