Type: Neutral
Formula: C22H23N5O
SMILES: |
o1c2c(ncnc2NCc2cccnc2)c2c3c(CCC3)c(nc12)CC(C)C |
InChI: |
InChI=1/C22H23N5O/c1-13(2)9-17-15-6-3-7-16(15)18-19-20(28-22(18)27-17)21(26-12-25-19)24-11-14-5-4-8-23-10-14/h4-5,8,10,12-13H,3,6-7,9,11H2,1-2H3,(H,24,25,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 373.46 g/mol | logS: -6.26556 | SlogP: 4.73161 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0393864 | Sterimol/B1: 2.40954 | Sterimol/B2: 2.49685 | Sterimol/B3: 4.60492 |
Sterimol/B4: 9.10274 | Sterimol/L: 17.5834 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 660.187 | Positive charged surface: 492.501 | Negative charged surface: 161.496 | Volume: 367.125 |
Hydrophobic surface: 489.417 | Hydrophilic surface: 170.77 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |