Type: Neutral
Formula: C18H21N2O7P2S+
SMILES: |
s1cc([n+](CCC(P(O)(O)=O)(P(O)(O)=O)O)c1Nc1ccccc1)-c1ccccc1 |
InChI: |
InChI=1/C18H20N2O7P2S/c21-18(28(22,23)24,29(25,26)27)11-12-20-16(14-7-3-1-4-8-14)13-30-17(20)19-15-9-5-2-6-10-15/h1-10,13,21H,11-12H2,(H4,22,23,24,25,26,27)/p+1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 471.387 g/mol | logS: -3.51348 | SlogP: 0.9638 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.126629 | Sterimol/B1: 3.55344 | Sterimol/B2: 4.30392 | Sterimol/B3: 4.58543 |
Sterimol/B4: 9.00618 | Sterimol/L: 16.2308 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 636.799 | Positive charged surface: 303.255 | Negative charged surface: 333.545 | Volume: 384.75 |
Hydrophobic surface: 396.409 | Hydrophilic surface: 240.39 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 2 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |