Type: Neutral
Formula: C24H28N4O2S
SMILES: |
S(=O)(=O)(Nc1nc2c(nc1NCCC=1CCCCC=1)cccc2)c1cc(C)c(cc1)C |
InChI: |
InChI=1/C24H28N4O2S/c1-17-12-13-20(16-18(17)2)31(29,30)28-24-23(25-15-14-19-8-4-3-5-9-19)26-21-10-6-7-11-22(21)27-24/h6-8,10-13,16H,3-5,9,14-15H2,1-2H3,(H,25,26)(H,27,28) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 436.58 g/mol | logS: -5.68009 | SlogP: 5.34984 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0880742 | Sterimol/B1: 2.21113 | Sterimol/B2: 3.48279 | Sterimol/B3: 7.31734 |
Sterimol/B4: 8.92513 | Sterimol/L: 18.9409 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 720.766 | Positive charged surface: 453.079 | Negative charged surface: 267.687 | Volume: 417.5 |
Hydrophobic surface: 586.4 | Hydrophilic surface: 134.366 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |