Type: Neutral
Formula: C9H15NO6P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)CNc1ccc(cc1)C |
InChI: |
InChI=1/C9H15NO6P2/c1-7-2-4-8(5-3-7)10-6-9(17(11,12)13)18(14,15)16/h2-5,9-10H,6H2,1H3,(H2,11,12,13)(H2,14,15,16) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 295.168 g/mol | logS: -0.19695 | SlogP: -1.05198 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.131902 | Sterimol/B1: 3.57417 | Sterimol/B2: 3.72743 | Sterimol/B3: 4.29443 |
Sterimol/B4: 4.86522 | Sterimol/L: 13.7171 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 473.783 | Positive charged surface: 255.644 | Negative charged surface: 218.139 | Volume: 235 |
Hydrophobic surface: 245.975 | Hydrophilic surface: 227.808 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |