 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)([O-])(=[NH])c1ccc(cc1)CN1C(=O)C(NC1=O)C(CC)C |
| InChI: | InChI=1/C14H19N3O4S/c1-3-9(2)12-13(18)17(14(19)16-12)8-10-4-6-11(7-5-10)22(15,20)21/h4-7,9,12H,3,8H2,1-2H3,(H3,15,16,19,20,21)/p-1/t9-,12+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=11.8372 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 324.381 g/mol | logS: -3.29936 | SlogP: 1.3911 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0818586 | Sterimol/B1: 3.15917 | Sterimol/B2: 3.69345 | Sterimol/B3: 4.05286 | |||
| Sterimol/B4: 5.75862 | Sterimol/L: 17.3572 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 541.5 | Positive charged surface: 295.028 | Negative charged surface: 246.471 | Volume: 288.25 | |||
| Hydrophobic surface: 310.214 | Hydrophilic surface: 231.286 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
