Type: Neutral
Formula: C17H22N2O8
SMILES: |
O1C2C(OC(OC2)(C)C)C(O)C(NC(=O)C)C1Oc1ccc([N+](=O)[O-])cc1 |
InChI: |
InChI=1/C17H22N2O8/c1-9(20)18-13-14(21)15-12(8-24-17(2,3)27-15)26-16(13)25-11-6-4-10(5-7-11)19(22)23/h4-7,12-16,21H,8H2,1-3H3,(H,18,20)/t12-,13-,14-,15+,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 382.369 g/mol | logS: -3.51959 | SlogP: 0.7156 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.140246 | Sterimol/B1: 2.22344 | Sterimol/B2: 3.82289 | Sterimol/B3: 4.22943 |
Sterimol/B4: 10.2402 | Sterimol/L: 15.5916 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 606.102 | Positive charged surface: 359.596 | Negative charged surface: 246.506 | Volume: 333.875 |
Hydrophobic surface: 397.291 | Hydrophilic surface: 208.811 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |