Type: Neutral
Formula: C17H21N2O2P
SMILES: |
P(O)(=O)(N1CCCCC1c1cccnc1)Cc1ccccc1 |
InChI: |
InChI=1/C17H21N2O2P/c20-22(21,14-15-7-2-1-3-8-15)19-12-5-4-10-17(19)16-9-6-11-18-13-16/h1-3,6-9,11,13,17H,4-5,10,12,14H2,(H,20,21)/t17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 316.341 g/mol | logS: -1.81632 | SlogP: 3.2859 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.128692 | Sterimol/B1: 3.31644 | Sterimol/B2: 3.75081 | Sterimol/B3: 5.63194 |
Sterimol/B4: 6.28176 | Sterimol/L: 14.1406 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 540.078 | Positive charged surface: 363.746 | Negative charged surface: 176.332 | Volume: 305.5 |
Hydrophobic surface: 489.637 | Hydrophilic surface: 50.441 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |