 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(CC(C)C)C(=O)NC(C(O)=O)C)C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C17H21N3O5/c1-9(2)8-13(14(21)18-10(3)16(23)24)20-15(22)11-6-4-5-7-12(11)19-17(20)25/h4-7,9-10,13H,8H2,1-3H3,(H,18,21)(H,19,25)(H,23,24)/t10-,13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=50.3356 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 347.371 g/mol | logS: -3.88695 | SlogP: 1.6783 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.141426 | Sterimol/B1: 2.27427 | Sterimol/B2: 3.03406 | Sterimol/B3: 4.92432 | |||
| Sterimol/B4: 8.70933 | Sterimol/L: 16.4189 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 582.713 | Positive charged surface: 351.969 | Negative charged surface: 230.744 | Volume: 317.5 | |||
| Hydrophobic surface: 340.737 | Hydrophilic surface: 241.976 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
