 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(CC(C)C)C(=O)NC(C(=O)[O-])c2ccccc2)C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C22H23N3O5/c1-13(2)12-17(19(26)24-18(21(28)29)14-8-4-3-5-9-14)25-20(27)15-10-6-7-11-16(15)23-22(25)30/h3-11,13,17-18H,12H2,1-2H3,(H,23,30)(H,24,26)(H,28,29)/p-1/t17-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=61.293 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 408.434 g/mol | logS: -5.58809 | SlogP: 1.7919 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.161744 | Sterimol/B1: 2.01728 | Sterimol/B2: 3.92085 | Sterimol/B3: 4.68752 | |||
| Sterimol/B4: 10.0132 | Sterimol/L: 15.6553 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 659.327 | Positive charged surface: 358.419 | Negative charged surface: 300.907 | Volume: 383.875 | |||
| Hydrophobic surface: 456.891 | Hydrophilic surface: 202.436 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
